C20H21F5N6O2 — CID 129216645
N-[3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129216645) has the molecular formula C20H21F5N6O2 and a molecular weight of 472.42 g/mol. Its IUPAC name is N-[3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129216645 |
| Molecular Formula | C20H21F5N6O2 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2CC3CCC(C2)C3Nc2nc3c(OCC(F)(F)C(F)(F)F)cccn3n2)on1 |
| InChI | InChI=1S/C20H21F5N6O2/c1-11-7-15(33-29-11)30-8-12-4-5-13(9-30)16(12)26-18-27-17-14(3-2-6-31(17)28-18)32-10-19(21,22)20(23,24)25/h2-3,6-7,12-13,16H,4-5,8-10H2,1H3,(H,26,28) |
| InChIKey | IRINTXPZAZNXNO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|