C10H7BrF5N3O — CID 129216777
2-bromo-5-methyl-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 129216777) has the molecular formula C10H7BrF5N3O and a molecular weight of 360.08 g/mol. Its IUPAC name is 2-bromo-5-methyl-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-bromo-5-methyl-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 129216777 |
| Molecular Formula | C10H7BrF5N3O |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 2-bromo-5-methyl-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1ccc(OCC(F)(F)C(F)(F)F)c2nc(Br)nn12 |
| InChI | InChI=1S/C10H7BrF5N3O/c1-5-2-3-6(7-17-8(11)18-19(5)7)20-4-9(12,13)10(14,15)16/h2-3H,4H2,1H3 |
| InChIKey | AWEBOJDWBVHJQA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|