About cyclohexanone;2-(2-methoxypropoxy)propan-1-ol
cyclohexanone;2-(2-methoxypropoxy)propan-1-ol (PubChem CID 129216839) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is cyclohexanone;2-(2-methoxypropoxy)propan-1-ol.
Molecular Properties
| Compound Name | cyclohexanone;2-(2-methoxypropoxy)propan-1-ol |
| PubChem CID | 129216839 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | cyclohexanone;2-(2-methoxypropoxy)propan-1-ol |
| SMILES | COC(C)COC(C)CO.O=C1CCCCC1 |
| InChI | InChI=1S/C7H16O3.C6H10O/c1-6(4-8)10-5-7(2)9-3;7-6-4-2-1-3-5-6/h6-8H,4-5H2,1-3H3;1-5H2 |
| InChIKey | YJBCDXUKQFVBEL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexanone;2-(2-methoxypropoxy)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanone;2-(2-methoxypropoxy)propan-1-ol?
The IUPAC name of cyclohexanone;2-(2-methoxypropoxy)propan-1-ol (CID 129216839) is cyclohexanone;2-(2-methoxypropoxy)propan-1-ol.
What is the SMILES notation for cyclohexanone;2-(2-methoxypropoxy)propan-1-ol?
The canonical SMILES for cyclohexanone;2-(2-methoxypropoxy)propan-1-ol is COC(C)COC(C)CO.O=C1CCCCC1.
What is the InChIKey of cyclohexanone;2-(2-methoxypropoxy)propan-1-ol?
The InChIKey is YJBCDXUKQFVBEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O3.C6H10O/c1-6(4-8)10-5-7(2)9-3;7-6-4-2-1-3-5-6/h6-8H,4-5H2,1-3H3;1-5H2.
What are the key properties of cyclohexanone;2-(2-methoxypropoxy)propan-1-ol?
cyclohexanone;2-(2-methoxypropoxy)propan-1-ol has a molecular weight of 246.35 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanone;2-(2-methoxypropoxy)propan-1-ol is sourced from PubChem (CID 129216839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).