C16H10F6O10S2 — CID 129216858
dimethyl 3,7-bis(trifluoromethylsulfonyloxy)naphthalene-2,6-dicarboxylate (PubChem CID 129216858) has the molecular formula C16H10F6O10S2 and a molecular weight of 540.37 g/mol. Its IUPAC name is dimethyl 3,7-bis(trifluoromethylsulfonyloxy)naphthalene-2,6-dicarboxylate.
| Compound Name | dimethyl 3,7-bis(trifluoromethylsulfonyloxy)naphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 129216858 |
| Molecular Formula | C16H10F6O10S2 |
| Molecular Weight | 540.37 g/mol |
| Exact Mass | 539.96 |
| IUPAC Name | dimethyl 3,7-bis(trifluoromethylsulfonyloxy)naphthalene-2,6-dicarboxylate |
| SMILES | COC(=O)c1cc2cc(OS(=O)(=O)C(F)(F)F)c(C(=O)OC)cc2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H10F6O10S2/c1-29-13(23)9-3-7-6-12(32-34(27,28)16(20,21)22)10(14(24)30-2)4-8(7)5-11(9)31-33(25,26)15(17,18)19/h3-6H,1-2H3 |
| InChIKey | WKFSSBSVZCXOMK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|