C18H17N5O3 — CID 129216901
3-[5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)pyrimidin-2-yl]oxy-2-ethylbenzonitrile (PubChem CID 129216901) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 3-[5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)pyrimidin-2-yl]oxy-2-ethylbenzonitrile.
| Compound Name | 3-[5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)pyrimidin-2-yl]oxy-2-ethylbenzonitrile |
|---|---|
| PubChem CID | 129216901 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-[5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)pyrimidin-2-yl]oxy-2-ethylbenzonitrile |
| SMILES | CCc1c(C#N)cccc1Oc1ncc(N2C(=O)NC(C)(C)C2=O)cn1 |
| InChI | InChI=1S/C18H17N5O3/c1-4-13-11(8-19)6-5-7-14(13)26-16-20-9-12(10-21-16)23-15(24)18(2,3)22-17(23)25/h5-7,9-10H,4H2,1-3H3,(H,22,25) |
| InChIKey | FRXPHMJTHGNPLX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|