C6H14O22P2S6 — CID 129216949
[(1R,2R,3R,4R,5R,6S)-2-dihydroxyphosphinothioyloxy-3,4,5,6-tetrasulfooxycyclohexyl]oxy-sulfanylphosphinic acid (PubChem CID 129216949) has the molecular formula C6H14O22P2S6 and a molecular weight of 692.51 g/mol. Its IUPAC name is [(1R,2R,3R,4R,5R,6S)-2-dihydroxyphosphinothioyloxy-3,4,5,6-tetrasulfooxycyclohexyl]oxy-sulfanylphosphinic acid.
| Compound Name | [(1R,2R,3R,4R,5R,6S)-2-dihydroxyphosphinothioyloxy-3,4,5,6-tetrasulfooxycyclohexyl]oxy-sulfanylphosphinic acid |
|---|---|
| PubChem CID | 129216949 |
| Molecular Formula | C6H14O22P2S6 |
| Molecular Weight | 692.51 g/mol |
| Exact Mass | 691.78 |
| IUPAC Name | [(1R,2R,3R,4R,5R,6S)-2-dihydroxyphosphinothioyloxy-3,4,5,6-tetrasulfooxycyclohexyl]oxy-sulfanylphosphinic acid |
| SMILES | O=P(O)(S)O[C@@H]1[C@@H](OP(O)(O)=S)[C@@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C6H14O22P2S6/c7-29(8,31)23-1-2(24-30(9,10)32)4(26-34(14,15)16)6(28-36(20,21)22)5(27-35(17,18)19)3(1)25-33(11,12)13/h1-6H,(H2,7,8,31)(H2,9,10,32)(H,11,12,13)(H,14,15,16)(H,17,18,19)(H,20,21,22)/t1-,2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | AUTMTQGXPWVTJN-XCMZKKERSA-N |
| XLogP | -3.24 |
| TPSA | 350.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.51 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|