C14H11ClN4O3S — CID 129217351
3-[(7-chloro-1,1,5-trihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)amino]benzonitrile (PubChem CID 129217351) has the molecular formula C14H11ClN4O3S and a molecular weight of 350.79 g/mol. Its IUPAC name is 3-[(7-chloro-1,1,5-trihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)amino]benzonitrile.
| Compound Name | 3-[(7-chloro-1,1,5-trihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 129217351 |
| Molecular Formula | C14H11ClN4O3S |
| Molecular Weight | 350.79 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 3-[(7-chloro-1,1,5-trihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)amino]benzonitrile |
| SMILES | N#Cc1cccc(NC2=NS(O)(O)c3cc(Cl)cc(O)c3N2)c1 |
| InChI | InChI=1S/C14H11ClN4O3S/c15-9-5-11(20)13-12(6-9)23(21,22)19-14(18-13)17-10-3-1-2-8(4-10)7-16/h1-6,20-22H,(H2,17,18,19) |
| InChIKey | UNEYWXKILSXXTF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.79 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|