About 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol
7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol (PubChem CID 129218079) has the molecular formula C15H11FN4OS
and a molecular weight of 314.35 g/mol. Its IUPAC name is 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol.
Molecular Properties
| Compound Name | 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol |
| PubChem CID | 129218079 |
| Molecular Formula | C15H11FN4OS |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol |
| SMILES | Oc1cc(F)cc2c1N=C(Nc1ccc3cc[nH]c3c1)NS2 |
| InChI | InChI=1S/C15H11FN4OS/c16-9-5-12(21)14-13(6-9)22-20-15(19-14)18-10-2-1-8-3-4-17-11(8)7-10/h1-7,17,21H,(H2,18,19,20) |
| InChIKey | VMAUQAPIUUDNFO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol?
The IUPAC name of 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol (CID 129218079) is 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol.
What is the SMILES notation for 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol?
The canonical SMILES for 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol is Oc1cc(F)cc2c1N=C(Nc1ccc3cc[nH]c3c1)NS2.
What is the InChIKey of 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol?
The InChIKey is VMAUQAPIUUDNFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FN4OS/c16-9-5-12(21)14-13(6-9)22-20-15(19-14)18-10-2-1-8-3-4-17-11(8)7-10/h1-7,17,21H,(H2,18,19,20).
What are the key properties of 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol?
7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol has a molecular weight of 314.35 g/mol, XLogP of 3.72, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3-(1H-indol-6-ylamino)-2H-1,2,4-benzothiadiazin-5-ol is sourced from PubChem (CID 129218079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).