C15H26NO9P — CID 129218840
3-[[(2S,4R)-2-(2,2-dimethylpropanoyloxymethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoic acid (PubChem CID 129218840) has the molecular formula C15H26NO9P and a molecular weight of 395.35 g/mol. Its IUPAC name is 3-[[(2S,4R)-2-(2,2-dimethylpropanoyloxymethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[(2S,4R)-2-(2,2-dimethylpropanoyloxymethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 129218840 |
| Molecular Formula | C15H26NO9P |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-[[(2S,4R)-2-(2,2-dimethylpropanoyloxymethoxy)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinane-4-carbonyl]amino]propanoic acid |
| SMILES | CC(C)(C)C(=O)OCO[P@@]1(=O)OCC(C)(C)[C@H](C(=O)NCCC(=O)O)O1 |
| InChI | InChI=1S/C15H26NO9P/c1-14(2,3)13(20)22-9-24-26(21)23-8-15(4,5)11(25-26)12(19)16-7-6-10(17)18/h11H,6-9H2,1-5H3,(H,16,19)(H,17,18)/t11-,26+/m0/s1 |
| InChIKey | VMXMCYHTLXOPGJ-KPHLJTLVSA-N |
| XLogP | 1.69 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|