3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid

C10H18F2N2O2 — CID 129219769

IUPAC3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid
SMILESNC(CCN1CCC(F)(F)CC1)CC(=O)O
InChIInChI=1S/C10H18F2N2O2/c11-10(12)2-5-14(6-3-10)4-1-8(13)7-9(15)16/h8H,1-7,13H2,(H,15,16)
InChIKeyBQSWEEUSQXRSOL-UHFFFAOYSA-N
MW236.26 g/mol
LogP0.91
Rot. Bonds5

About 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid

3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid (PubChem CID 129219769) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid.

Molecular Properties

Compound Name3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid
PubChem CID129219769
Molecular FormulaC10H18F2N2O2
Molecular Weight236.26 g/mol
Exact Mass236.13
IUPAC Name3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid
SMILESNC(CCN1CCC(F)(F)CC1)CC(=O)O
InChIInChI=1S/C10H18F2N2O2/c11-10(12)2-5-14(6-3-10)4-1-8(13)7-9(15)16/h8H,1-7,13H2,(H,15,16)
InChIKeyBQSWEEUSQXRSOL-UHFFFAOYSA-N
XLogP0.91
TPSA66.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.26
LogP ≤ 50.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid?
The IUPAC name of 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid (CID 129219769) is 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid.
What is the SMILES notation for 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid?
The canonical SMILES for 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid is NC(CCN1CCC(F)(F)CC1)CC(=O)O.
What is the InChIKey of 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid?
The InChIKey is BQSWEEUSQXRSOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O2/c11-10(12)2-5-14(6-3-10)4-1-8(13)7-9(15)16/h8H,1-7,13H2,(H,15,16).
What are the key properties of 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid?
3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid has a molecular weight of 236.26 g/mol, XLogP of 0.91, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(4,4-difluoropiperidin-1-yl)pentanoic acid is sourced from PubChem (CID 129219769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).