About 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid
5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid (PubChem CID 129219879) has the molecular formula C10H15F2NO2
and a molecular weight of 219.23 g/mol. Its IUPAC name is 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid.
Molecular Properties
| Compound Name | 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid |
| PubChem CID | 129219879 |
| Molecular Formula | C10H15F2NO2 |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid |
| SMILES | O=C(O)C=CCCN1CCCC(F)C1F |
| InChI | InChI=1S/C10H15F2NO2/c11-8-4-3-7-13(10(8)12)6-2-1-5-9(14)15/h1,5,8,10H,2-4,6-7H2,(H,14,15) |
| InChIKey | XHSIPUNSIJOYHX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid?
The IUPAC name of 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid (CID 129219879) is 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid.
What is the SMILES notation for 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid?
The canonical SMILES for 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid is O=C(O)C=CCCN1CCCC(F)C1F.
What is the InChIKey of 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid?
The InChIKey is XHSIPUNSIJOYHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2NO2/c11-8-4-3-7-13(10(8)12)6-2-1-5-9(14)15/h1,5,8,10H,2-4,6-7H2,(H,14,15).
What are the key properties of 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid?
5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid has a molecular weight of 219.23 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-difluoropiperidin-1-yl)pent-2-enoic acid is sourced from PubChem (CID 129219879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).