C25H23N7O3S — CID 129219931
7-(3-methyl-5-phenoxypyrazin-2-yl)-6-oxo-N-[(3R)-piperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129219931) has the molecular formula C25H23N7O3S and a molecular weight of 501.57 g/mol. Its IUPAC name is 7-(3-methyl-5-phenoxypyrazin-2-yl)-6-oxo-N-[(3R)-piperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(3-methyl-5-phenoxypyrazin-2-yl)-6-oxo-N-[(3R)-piperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129219931 |
| Molecular Formula | C25H23N7O3S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 7-(3-methyl-5-phenoxypyrazin-2-yl)-6-oxo-N-[(3R)-piperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1nc(Oc2ccccc2)cnc1N1C(=O)Nc2c(C(=O)N[C@@H]3CCCNC3)sc3nccc1c23 |
| InChI | InChI=1S/C25H23N7O3S/c1-14-22(28-13-18(29-14)35-16-7-3-2-4-8-16)32-17-9-11-27-24-19(17)20(31-25(32)34)21(36-24)23(33)30-15-6-5-10-26-12-15/h2-4,7-9,11,13,15,26H,5-6,10,12H2,1H3,(H,30,33)(H,31,34)/t15-/m1/s1 |
| InChIKey | WCSWULFWLYFGJE-OAHLLOKOSA-N |
| XLogP | 4.35 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |