C28H26N4O5S — CID 129220266
N-[4-(hydroxymethyl)oxan-4-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129220266) has the molecular formula C28H26N4O5S and a molecular weight of 530.61 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)oxan-4-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[4-(hydroxymethyl)oxan-4-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129220266 |
| Molecular Formula | C28H26N4O5S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | N-[4-(hydroxymethyl)oxan-4-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)Nc2c(C(=O)NC3(CO)CCOCC3)sc3nccc1c23 |
| InChI | InChI=1S/C28H26N4O5S/c1-17-15-19(37-18-5-3-2-4-6-18)7-8-20(17)32-21-9-12-29-26-22(21)23(30-27(32)35)24(38-26)25(34)31-28(16-33)10-13-36-14-11-28/h2-9,12,15,33H,10-11,13-14,16H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | YRVNQMQHYHDEPF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |