C26H22FN5O3S — CID 129220338
7-(2-fluoro-4-phenoxyphenyl)-6-oxo-N-[(3R)-piperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129220338) has the molecular formula C26H22FN5O3S and a molecular weight of 503.56 g/mol. Its IUPAC name is 7-(2-fluoro-4-phenoxyphenyl)-6-oxo-N-[(3R)-piperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(2-fluoro-4-phenoxyphenyl)-6-oxo-N-[(3R)-piperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129220338 |
| Molecular Formula | C26H22FN5O3S |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 7-(2-fluoro-4-phenoxyphenyl)-6-oxo-N-[(3R)-piperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCNC1)c1sc2nccc3c2c1NC(=O)N3c1ccc(Oc2ccccc2)cc1F |
| InChI | InChI=1S/C26H22FN5O3S/c27-18-13-17(35-16-6-2-1-3-7-16)8-9-19(18)32-20-10-12-29-25-21(20)22(31-26(32)34)23(36-25)24(33)30-15-5-4-11-28-14-15/h1-3,6-10,12-13,15,28H,4-5,11,14H2,(H,30,33)(H,31,34)/t15-/m1/s1 |
| InChIKey | MWIIJABSEUUWSO-OAHLLOKOSA-N |
| XLogP | 5.39 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |