C22H15N3O4S — CID 129220617
7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid (PubChem CID 129220617) has the molecular formula C22H15N3O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is 7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid.
| Compound Name | 7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 129220617 |
| Molecular Formula | C22H15N3O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)Nc2c(C(=O)O)sc3nccc1c23 |
| InChI | InChI=1S/C22H15N3O4S/c1-12-11-14(29-13-5-3-2-4-6-13)7-8-15(12)25-16-9-10-23-20-17(16)18(24-22(25)28)19(30-20)21(26)27/h2-11H,1H3,(H,24,28)(H,26,27) |
| InChIKey | QKKAPTLZIAJPCP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |