C20H12N4O3S — CID 129220760
6-oxo-7-(3-pyridin-2-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid (PubChem CID 129220760) has the molecular formula C20H12N4O3S and a molecular weight of 388.41 g/mol. Its IUPAC name is 6-oxo-7-(3-pyridin-2-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid.
| Compound Name | 6-oxo-7-(3-pyridin-2-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 129220760 |
| Molecular Formula | C20H12N4O3S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 6-oxo-7-(3-pyridin-2-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
| SMILES | O=C(O)c1sc2nccc3c2c1NC(=O)N3c1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C20H12N4O3S/c25-19(26)17-16-15-14(7-9-22-18(15)28-17)24(20(27)23-16)12-5-3-4-11(10-12)13-6-1-2-8-21-13/h1-10H,(H,23,27)(H,25,26) |
| InChIKey | HVDCRUOQKGUKNV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |