C17H14N4O3S — CID 129220811
6-oxo-7-(2-propan-2-yl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid (PubChem CID 129220811) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 6-oxo-7-(2-propan-2-yl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid.
| Compound Name | 6-oxo-7-(2-propan-2-yl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 129220811 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 6-oxo-7-(2-propan-2-yl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
| SMILES | CC(C)c1cc(N2C(=O)Nc3c(C(=O)O)sc4nccc2c34)ccn1 |
| InChI | InChI=1S/C17H14N4O3S/c1-8(2)10-7-9(3-5-18-10)21-11-4-6-19-15-12(11)13(20-17(21)24)14(25-15)16(22)23/h3-8H,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | DPPUCGCLLGQPNA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |