C20H29N5OS — CID 129221287
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-cyano-2-methoxybenzenecarboximidothioate (PubChem CID 129221287) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-cyano-2-methoxybenzenecarboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-cyano-2-methoxybenzenecarboximidothioate |
|---|---|
| PubChem CID | 129221287 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-cyano-2-methoxybenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(C#N)cc1OC)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H29N5OS/c1-19(2)10-14(11-20(3,4)24-19)25(5)18(23)27-17(22)15-8-7-13(12-21)9-16(15)26-6/h7-9,14,22-24H,10-11H2,1-6H3/b22-17+,23-18- |
| InChIKey | JIYYWFIFWVGLAL-OZSYXFNUSA-N |
| XLogP | 3.80 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|