C24H33N5O2S — CID 129221290
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-methoxy-4-(6-oxo-1H-pyridin-3-yl)benzenecarboximidothioate (PubChem CID 129221290) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-methoxy-4-(6-oxo-1H-pyridin-3-yl)benzenecarboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-methoxy-4-(6-oxo-1H-pyridin-3-yl)benzenecarboximidothioate |
|---|---|
| PubChem CID | 129221290 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-methoxy-4-(6-oxo-1H-pyridin-3-yl)benzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(-c2ccc(=O)[nH]c2)cc1OC)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H33N5O2S/c1-23(2)12-17(13-24(3,4)28-23)29(5)22(26)32-21(25)18-9-7-15(11-19(18)31-6)16-8-10-20(30)27-14-16/h7-11,14,17,25-26,28H,12-13H2,1-6H3,(H,27,30)/b25-21+,26-22- |
| InChIKey | FLHHXFVBNCQHLZ-AERNQAQFSA-N |
| XLogP | 4.28 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|