C25H35N5O2S — CID 129221295
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-methoxy-4-(1-methyl-6-oxo-3-pyridinyl)benzenecarboximidothioate (PubChem CID 129221295) has the molecular formula C25H35N5O2S and a molecular weight of 469.66 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-methoxy-4-(1-methyl-6-oxo-3-pyridinyl)benzenecarboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-methoxy-4-(1-methyl-6-oxo-3-pyridinyl)benzenecarboximidothioate |
|---|---|
| PubChem CID | 129221295 |
| Molecular Formula | C25H35N5O2S |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-methoxy-4-(1-methyl-6-oxo-3-pyridinyl)benzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(-c2ccc(=O)n(C)c2)cc1OC)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C25H35N5O2S/c1-24(2)13-18(14-25(3,4)28-24)30(6)23(27)33-22(26)19-10-8-16(12-20(19)32-7)17-9-11-21(31)29(5)15-17/h8-12,15,18,26-28H,13-14H2,1-7H3/b26-22+,27-23- |
| InChIKey | IXBCRIBCFYFGHL-FLPXOHCLSA-N |
| XLogP | 4.30 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|