About 7-bromo-5-phenylpyrido[4,3-b]indole
7-bromo-5-phenylpyrido[4,3-b]indole (PubChem CID 129221574) has the molecular formula C17H11BrN2
and a molecular weight of 323.19 g/mol. Its IUPAC name is 7-bromo-5-phenylpyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 7-bromo-5-phenylpyrido[4,3-b]indole |
| PubChem CID | 129221574 |
| Molecular Formula | C17H11BrN2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 7-bromo-5-phenylpyrido[4,3-b]indole |
| SMILES | Brc1ccc2c3cnccc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C17H11BrN2/c18-12-6-7-14-15-11-19-9-8-16(15)20(17(14)10-12)13-4-2-1-3-5-13/h1-11H |
| InChIKey | BHOYHRSPDWWSAL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-5-phenylpyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-phenylpyrido[4,3-b]indole?
The IUPAC name of 7-bromo-5-phenylpyrido[4,3-b]indole (CID 129221574) is 7-bromo-5-phenylpyrido[4,3-b]indole.
What is the SMILES notation for 7-bromo-5-phenylpyrido[4,3-b]indole?
The canonical SMILES for 7-bromo-5-phenylpyrido[4,3-b]indole is Brc1ccc2c3cnccc3n(-c3ccccc3)c2c1.
What is the InChIKey of 7-bromo-5-phenylpyrido[4,3-b]indole?
The InChIKey is BHOYHRSPDWWSAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BrN2/c18-12-6-7-14-15-11-19-9-8-16(15)20(17(14)10-12)13-4-2-1-3-5-13/h1-11H.
What are the key properties of 7-bromo-5-phenylpyrido[4,3-b]indole?
7-bromo-5-phenylpyrido[4,3-b]indole has a molecular weight of 323.19 g/mol, XLogP of 4.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-phenylpyrido[4,3-b]indole is sourced from PubChem (CID 129221574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).