C10H20O4S — CID 129222063
2-[(1R,3S)-3-hydroxy-1,2,2-trimethylcyclopentyl]ethanesulfonic acid (PubChem CID 129222063) has the molecular formula C10H20O4S and a molecular weight of 236.33 g/mol. Its IUPAC name is 2-[(1R,3S)-3-hydroxy-1,2,2-trimethylcyclopentyl]ethanesulfonic acid.
| Compound Name | 2-[(1R,3S)-3-hydroxy-1,2,2-trimethylcyclopentyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 129222063 |
| Molecular Formula | C10H20O4S |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-[(1R,3S)-3-hydroxy-1,2,2-trimethylcyclopentyl]ethanesulfonic acid |
| SMILES | CC1(C)[C@@H](O)CC[C@]1(C)CCS(=O)(=O)O |
| InChI | InChI=1S/C10H20O4S/c1-9(2)8(11)4-5-10(9,3)6-7-15(12,13)14/h8,11H,4-7H2,1-3H3,(H,12,13,14)/t8-,10+/m0/s1 |
| InChIKey | BUQQBWFZNUFSEG-WCBMZHEXSA-N |
| XLogP | 1.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|