C12H15NS — CID 129222106
(3aE,6Z,9E)-2,5,8-trimethyl-5,8-dihydrocycloocta[d][1,3]thiazole (PubChem CID 129222106) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is (3aE,6Z,9E)-2,5,8-trimethyl-5,8-dihydrocycloocta[d][1,3]thiazole.
| Compound Name | (3aE,6Z,9E)-2,5,8-trimethyl-5,8-dihydrocycloocta[d][1,3]thiazole |
|---|---|
| PubChem CID | 129222106 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (3aE,6Z,9E)-2,5,8-trimethyl-5,8-dihydrocycloocta[d][1,3]thiazole |
| SMILES | Cc1nc2/c(s1)=C\C(C)/C=C\C(C)/C=2 |
| InChI | InChI=1S/C12H15NS/c1-8-4-5-9(2)7-12-11(6-8)13-10(3)14-12/h4-9H,1-3H3/b5-4-,11-6+,12-7+ |
| InChIKey | ILRCVDSOMYRTME-DUZYKVORSA-N |
| XLogP | 1.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|