C11H17NO3 — CID 129222174
(E)-5-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]pent-3-en-2-one (PubChem CID 129222174) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is (E)-5-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 129222174 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (E)-5-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]pent-3-en-2-one |
| SMILES | CC(=O)/C=C/CN1C[C@@H]2OCCO[C@@H]2C1 |
| InChI | InChI=1S/C11H17NO3/c1-9(13)3-2-4-12-7-10-11(8-12)15-6-5-14-10/h2-3,10-11H,4-8H2,1H3/b3-2+/t10-,11+ |
| InChIKey | PTMAVOFONSOPRO-GOYQAJIHSA-N |
| XLogP | 0.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|