C31H38N8O2 — CID 129222241
1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-pyrrolidin-1-ylpyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine (PubChem CID 129222241) has the molecular formula C31H38N8O2 and a molecular weight of 554.70 g/mol. Its IUPAC name is 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-pyrrolidin-1-ylpyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-pyrrolidin-1-ylpyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 129222241 |
| Molecular Formula | C31H38N8O2 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | 1-N-[4-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-5-pyrrolidin-1-ylpyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-4-N,2-dimethyl-5-nitrobenzene-1,4-diamine |
| SMILES | Cc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc(N2CCCC2)c(-c2cn3c4c(cccc24)CCC3)n1 |
| InChI | InChI=1S/C31H38N8O2/c1-21-17-26(36(4)16-15-35(2)3)27(39(40)41)18-25(21)33-31-32-19-28(37-12-5-6-13-37)29(34-31)24-20-38-14-8-10-22-9-7-11-23(24)30(22)38/h7,9,11,17-20H,5-6,8,10,12-16H2,1-4H3,(H,32,33,34) |
| InChIKey | GOTNDRBEMFAKEX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|