C35H35F2N3O — CID 129222565
5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-2,4-difluorophenyl]-4,6-dimethyl-2-(4-phenylpiperidin-1-yl)pyrimidine (PubChem CID 129222565) has the molecular formula C35H35F2N3O and a molecular weight of 551.68 g/mol. Its IUPAC name is 5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-2,4-difluorophenyl]-4,6-dimethyl-2-(4-phenylpiperidin-1-yl)pyrimidine.
| Compound Name | 5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-2,4-difluorophenyl]-4,6-dimethyl-2-(4-phenylpiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 129222565 |
| Molecular Formula | C35H35F2N3O |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 5-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-2,4-difluorophenyl]-4,6-dimethyl-2-(4-phenylpiperidin-1-yl)pyrimidine |
| SMILES | Cc1nc(N2CCC(c3ccccc3)CC2)nc(C)c1-c1ccc(F)c(COc2ccc3c(c2)C[C@H]2[C@H](C)[C@@H]32)c1F |
| InChI | InChI=1S/C35H35F2N3O/c1-20-29-18-25-17-26(9-10-27(25)32(20)29)41-19-30-31(36)12-11-28(34(30)37)33-21(2)38-35(39-22(33)3)40-15-13-24(14-16-40)23-7-5-4-6-8-23/h4-12,17,20,24,29,32H,13-16,18-19H2,1-3H3/t20-,29-,32-/m0/s1 |
| InChIKey | UCCGFJVGCLHGLY-MAEJCCKSSA-N |
| XLogP | 7.91 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |