C31H25FN2OS — CID 129222566
6-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-7-methyl-2-pyridin-4-yl-1,3-benzothiazole (PubChem CID 129222566) has the molecular formula C31H25FN2OS and a molecular weight of 492.62 g/mol. Its IUPAC name is 6-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-7-methyl-2-pyridin-4-yl-1,3-benzothiazole.
| Compound Name | 6-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-7-methyl-2-pyridin-4-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 129222566 |
| Molecular Formula | C31H25FN2OS |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 6-[3-[[(1S,1aR,6aS)-1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl]oxymethyl]-4-fluorophenyl]-7-methyl-2-pyridin-4-yl-1,3-benzothiazole |
| SMILES | Cc1c(-c2ccc(F)c(COc3ccc4c(c3)C[C@H]3[C@H](C)[C@@H]43)c2)ccc2nc(-c3ccncc3)sc12 |
| InChI | InChI=1S/C31H25FN2OS/c1-17-26-15-21-14-23(4-5-25(21)29(17)26)35-16-22-13-20(3-7-27(22)32)24-6-8-28-30(18(24)2)36-31(34-28)19-9-11-33-12-10-19/h3-14,17,26,29H,15-16H2,1-2H3/t17-,26-,29-/m0/s1 |
| InChIKey | NXNCTXXKIQOQCL-WSXTTZOWSA-N |
| XLogP | 7.96 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |