C30H26FN5O2S — CID 129222959
N-[(3R)-1-buta-1,3-dien-2-ylpiperidin-3-yl]-7-[3-(3-fluorophenyl)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129222959) has the molecular formula C30H26FN5O2S and a molecular weight of 539.64 g/mol. Its IUPAC name is N-[(3R)-1-buta-1,3-dien-2-ylpiperidin-3-yl]-7-[3-(3-fluorophenyl)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(3R)-1-buta-1,3-dien-2-ylpiperidin-3-yl]-7-[3-(3-fluorophenyl)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129222959 |
| Molecular Formula | C30H26FN5O2S |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | N-[(3R)-1-buta-1,3-dien-2-ylpiperidin-3-yl]-7-[3-(3-fluorophenyl)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=C)N1CCC[C@@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2cccc(-c3cccc(F)c3)c2)C1 |
| InChI | InChI=1S/C30H26FN5O2S/c1-3-18(2)35-14-6-10-22(17-35)33-28(37)27-26-25-24(12-13-32-29(25)39-27)36(30(38)34-26)23-11-5-8-20(16-23)19-7-4-9-21(31)15-19/h3-5,7-9,11-13,15-16,22H,1-2,6,10,14,17H2,(H,33,37)(H,34,38)/t22-/m1/s1 |
| InChIKey | MATBYBWVMUZZEN-JOCHJYFZSA-N |
| XLogP | 6.68 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|