C31H27F2N5OS — CID 129223107
3-[1-[[(3R)-1-buta-1,3-dien-2-ylpiperidin-3-yl]amino]ethenyl]-7-[3-(2,4-difluorophenyl)phenyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one (PubChem CID 129223107) has the molecular formula C31H27F2N5OS and a molecular weight of 555.65 g/mol. Its IUPAC name is 3-[1-[[(3R)-1-buta-1,3-dien-2-ylpiperidin-3-yl]amino]ethenyl]-7-[3-(2,4-difluorophenyl)phenyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one.
| Compound Name | 3-[1-[[(3R)-1-buta-1,3-dien-2-ylpiperidin-3-yl]amino]ethenyl]-7-[3-(2,4-difluorophenyl)phenyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
|---|---|
| PubChem CID | 129223107 |
| Molecular Formula | C31H27F2N5OS |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 3-[1-[[(3R)-1-buta-1,3-dien-2-ylpiperidin-3-yl]amino]ethenyl]-7-[3-(2,4-difluorophenyl)phenyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
| SMILES | C=CC(=C)N1CCC[C@@H](NC(=C)c2sc3nccc4c3c2NC(=O)N4c2cccc(-c3ccc(F)cc3F)c2)C1 |
| InChI | InChI=1S/C31H27F2N5OS/c1-4-18(2)37-14-6-8-22(17-37)35-19(3)29-28-27-26(12-13-34-30(27)40-29)38(31(39)36-28)23-9-5-7-20(15-23)24-11-10-21(32)16-25(24)33/h4-5,7,9-13,15-16,22,35H,1-3,6,8,14,17H2,(H,36,39)/t22-/m1/s1 |
| InChIKey | BTULGTNETFNXQY-JOCHJYFZSA-N |
| XLogP | 7.65 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|