C14H20O5 — CID 129223206
(4R,5S)-2-(hydroxymethyl)-5-methyl-6-phenylmethoxyoxane-3,4-diol (PubChem CID 129223206) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (4R,5S)-2-(hydroxymethyl)-5-methyl-6-phenylmethoxyoxane-3,4-diol.
| Compound Name | (4R,5S)-2-(hydroxymethyl)-5-methyl-6-phenylmethoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 129223206 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (4R,5S)-2-(hydroxymethyl)-5-methyl-6-phenylmethoxyoxane-3,4-diol |
| SMILES | C[C@@H]1C(OCc2ccccc2)OC(CO)C(O)[C@@H]1O |
| InChI | InChI=1S/C14H20O5/c1-9-12(16)13(17)11(7-15)19-14(9)18-8-10-5-3-2-4-6-10/h2-6,9,11-17H,7-8H2,1H3/t9-,11?,12+,13?,14?/m0/s1 |
| InChIKey | CGOUNLDCQUIJOA-KDMVMBFYSA-N |
| XLogP | 0.28 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |