C21H12F2N4O2S — CID 129223258
7-[3-(2,3-difluorophenyl)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129223258) has the molecular formula C21H12F2N4O2S and a molecular weight of 422.42 g/mol. Its IUPAC name is 7-[3-(2,3-difluorophenyl)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[3-(2,3-difluorophenyl)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129223258 |
| Molecular Formula | C21H12F2N4O2S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 7-[3-(2,3-difluorophenyl)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | NC(=O)c1sc2nccc3c2c1NC(=O)N3c1cccc(-c2cccc(F)c2F)c1 |
| InChI | InChI=1S/C21H12F2N4O2S/c22-13-6-2-5-12(16(13)23)10-3-1-4-11(9-10)27-14-7-8-25-20-15(14)17(26-21(27)29)18(30-20)19(24)28/h1-9H,(H2,24,28)(H,26,29) |
| InChIKey | PXFMTLPUDZMBKE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |