C12H19NO3 — CID 129223382
(E)-6-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]hex-4-en-3-one (PubChem CID 129223382) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (E)-6-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]hex-4-en-3-one.
| Compound Name | (E)-6-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]hex-4-en-3-one |
|---|---|
| PubChem CID | 129223382 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (E)-6-[(4aS,7aR)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]hex-4-en-3-one |
| SMILES | CCC(=O)/C=C/CN1C[C@@H]2OCCO[C@@H]2C1 |
| InChI | InChI=1S/C12H19NO3/c1-2-10(14)4-3-5-13-8-11-12(9-13)16-7-6-15-11/h3-4,11-12H,2,5-9H2,1H3/b4-3+/t11-,12+ |
| InChIKey | PQHXRYNFMMXCRT-ROUHBEFFSA-N |
| XLogP | 0.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|