About 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate
4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate (PubChem CID 12922422) has the molecular formula C20H23ClN2O5
and a molecular weight of 406.87 g/mol. Its IUPAC name is 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate.
Molecular Properties
| Compound Name | 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate |
| PubChem CID | 12922422 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate |
| SMILES | CCCn1c(-c2ccccc2)c(OC)c(-c2ccccc2)[n+]1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H23N2O.ClHO4/c1-4-15-22-19(17-13-9-6-10-14-17)20(23-3)18(21(22)2)16-11-7-5-8-12-16;2-1(3,4)5/h5-14H,4,15H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LVACKXAKZSTXTG-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 110.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate?
The IUPAC name of 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate (CID 12922422) is 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate.
What is the SMILES notation for 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate?
The canonical SMILES for 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate is CCCn1c(-c2ccccc2)c(OC)c(-c2ccccc2)[n+]1C.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate?
The InChIKey is LVACKXAKZSTXTG-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H23N2O.ClHO4/c1-4-15-22-19(17-13-9-6-10-14-17)20(23-3)18(21(22)2)16-11-7-5-8-12-16;2-1(3,4)5/h5-14H,4,15H2,1-3H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate?
4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate has a molecular weight of 406.87 g/mol, XLogP of -0.69, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-methyl-3,5-diphenyl-2-propylpyrazol-1-ium perchlorate is sourced from PubChem (CID 12922422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).