About [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate
[(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate (PubChem CID 129224252) has the molecular formula C27H25FN4O4
and a molecular weight of 488.52 g/mol. Its IUPAC name is [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate.
Molecular Properties
| Compound Name | [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate |
| PubChem CID | 129224252 |
| Molecular Formula | C27H25FN4O4 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@H]1CN(Cc2ccccc2)[C@H](CF)C(OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H25FN4O4/c28-16-23-25(36-27(34)21-14-8-3-9-15-21)24(35-26(33)20-12-6-2-7-13-20)22(30-31-29)18-32(23)17-19-10-4-1-5-11-19/h1-15,22-25H,16-18H2/t22-,23+,24+,25?/m0/s1 |
| InChIKey | IIXGNSJMAKVALQ-QPDXQIEMSA-N |
| XLogP | 4.97 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate?
The IUPAC name of [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate (CID 129224252) is [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate.
What is the SMILES notation for [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate?
The canonical SMILES for [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate is [N-]=[N+]=N[C@H]1CN(Cc2ccccc2)[C@H](CF)C(OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1.
What is the InChIKey of [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate?
The InChIKey is IIXGNSJMAKVALQ-QPDXQIEMSA-N. The full InChI is InChI=1S/C27H25FN4O4/c28-16-23-25(36-27(34)21-14-8-3-9-15-21)24(35-26(33)20-12-6-2-7-13-20)22(30-31-29)18-32(23)17-19-10-4-1-5-11-19/h1-15,22-25H,16-18H2/t22-,23+,24+,25?/m0/s1.
What are the key properties of [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate?
[(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate has a molecular weight of 488.52 g/mol, XLogP of 4.97, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R,5S)-5-azido-3-benzoyloxy-1-benzyl-2-(fluoromethyl)piperidin-4-yl] benzoate is sourced from PubChem (CID 129224252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).