About 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one
1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one (PubChem CID 129225328) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one.
Molecular Properties
| Compound Name | 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one |
| PubChem CID | 129225328 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one |
| SMILES | Cc1c[nH]c2ccc3c(c12)CCC3=O |
| InChI | InChI=1S/C12H11NO/c1-7-6-13-10-4-2-8-9(12(7)10)3-5-11(8)14/h2,4,6,13H,3,5H2,1H3 |
| InChIKey | QHYBPBMIOKJBKM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one?
The IUPAC name of 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one (CID 129225328) is 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one.
What is the SMILES notation for 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one?
The canonical SMILES for 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one is Cc1c[nH]c2ccc3c(c12)CCC3=O.
What is the InChIKey of 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one?
The InChIKey is QHYBPBMIOKJBKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-7-6-13-10-4-2-8-9(12(7)10)3-5-11(8)14/h2,4,6,13H,3,5H2,1H3.
What are the key properties of 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one?
1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one has a molecular weight of 185.23 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7,8-dihydro-3H-cyclopenta[e]indol-6-one is sourced from PubChem (CID 129225328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).