C24H39NO2 — CID 12922543
(2E,6E,10E)-3,7,11,15-tetramethyl-1-morpholin-4-ylhexadeca-2,6,10,14-tetraen-1-one (PubChem CID 12922543) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is (2E,6E,10E)-3,7,11,15-tetramethyl-1-morpholin-4-ylhexadeca-2,6,10,14-tetraen-1-one.
| Compound Name | (2E,6E,10E)-3,7,11,15-tetramethyl-1-morpholin-4-ylhexadeca-2,6,10,14-tetraen-1-one |
|---|---|
| PubChem CID | 12922543 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | (2E,6E,10E)-3,7,11,15-tetramethyl-1-morpholin-4-ylhexadeca-2,6,10,14-tetraen-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H39NO2/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-14-23(5)19-24(26)25-15-17-27-18-16-25/h9,11,13,19H,6-8,10,12,14-18H2,1-5H3/b21-11+,22-13+,23-19+ |
| InChIKey | DPHRSMHYLGMYRP-CFXQGEQXSA-N |
| XLogP | 5.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|