C12H13N — CID 129225439
3-[(3E,5Z)-2-methylocta-1,3,5,7-tetraen-4-yl]azete (PubChem CID 129225439) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-[(3E,5Z)-2-methylocta-1,3,5,7-tetraen-4-yl]azete.
| Compound Name | 3-[(3E,5Z)-2-methylocta-1,3,5,7-tetraen-4-yl]azete |
|---|---|
| PubChem CID | 129225439 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-[(3E,5Z)-2-methylocta-1,3,5,7-tetraen-4-yl]azete |
| SMILES | C=C/C=C\C(=C/C(=C)C)C1=CN=C1 |
| InChI | InChI=1S/C12H13N/c1-4-5-6-11(7-10(2)3)12-8-13-9-12/h4-9H,1-2H2,3H3/b6-5-,11-7+ |
| InChIKey | ZDUATPSWHNHMQP-GNLLZQBYSA-N |
| XLogP | 3.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|