About (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine
(2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine (PubChem CID 129226484) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine.
Molecular Properties
| Compound Name | (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine |
| PubChem CID | 129226484 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine |
| SMILES | CCCN[C@@H]1O[C@@H]1C(C)C(C)(C)C |
| InChI | InChI=1S/C11H23NO/c1-6-7-12-10-9(13-10)8(2)11(3,4)5/h8-10,12H,6-7H2,1-5H3/t8?,9-,10-/m1/s1 |
| InChIKey | MOBRVJZRYLLUBZ-VXRWAFEHSA-N |
| XLogP | 2.39 |
| TPSA | 24.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine?
The IUPAC name of (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine (CID 129226484) is (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine.
What is the SMILES notation for (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine?
The canonical SMILES for (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine is CCCN[C@@H]1O[C@@H]1C(C)C(C)(C)C.
What is the InChIKey of (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine?
The InChIKey is MOBRVJZRYLLUBZ-VXRWAFEHSA-N. The full InChI is InChI=1S/C11H23NO/c1-6-7-12-10-9(13-10)8(2)11(3,4)5/h8-10,12H,6-7H2,1-5H3/t8?,9-,10-/m1/s1.
What are the key properties of (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine?
(2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine has a molecular weight of 185.31 g/mol, XLogP of 2.39, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-(3,3-dimethylbutan-2-yl)-N-propyloxiran-2-amine is sourced from PubChem (CID 129226484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).