About (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine
(3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine (PubChem CID 129226663) has the molecular formula C16H31N
and a molecular weight of 237.43 g/mol. Its IUPAC name is (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine.
Molecular Properties
| Compound Name | (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine |
| PubChem CID | 129226663 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine |
| SMILES | C=C(C)CCNC(=C)[C@H](CC)C(C)(C)CCC |
| InChI | InChI=1S/C16H31N/c1-8-11-16(6,7)15(9-2)14(5)17-12-10-13(3)4/h15,17H,3,5,8-12H2,1-2,4,6-7H3/t15-/m0/s1 |
| InChIKey | ZNQGZBFTYMTXPW-HNNXBMFYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine?
The IUPAC name of (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine (CID 129226663) is (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine.
What is the SMILES notation for (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine?
The canonical SMILES for (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine is C=C(C)CCNC(=C)[C@H](CC)C(C)(C)CCC.
What is the InChIKey of (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine?
The InChIKey is ZNQGZBFTYMTXPW-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H31N/c1-8-11-16(6,7)15(9-2)14(5)17-12-10-13(3)4/h15,17H,3,5,8-12H2,1-2,4,6-7H3/t15-/m0/s1.
What are the key properties of (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine?
(3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine has a molecular weight of 237.43 g/mol, XLogP of 4.91, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-ethyl-4,4-dimethyl-N-(3-methylbut-3-enyl)hept-1-en-2-amine is sourced from PubChem (CID 129226663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).