About 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde
2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde (PubChem CID 129227138) has the molecular formula C9H6BrNO2S
and a molecular weight of 272.12 g/mol. Its IUPAC name is 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde |
| PubChem CID | 129227138 |
| Molecular Formula | C9H6BrNO2S |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 270.93 |
| IUPAC Name | 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde |
| SMILES | O=CCn1ccc2scc(Br)c2c1=O |
| InChI | InChI=1S/C9H6BrNO2S/c10-6-5-14-7-1-2-11(3-4-12)9(13)8(6)7/h1-2,4-5H,3H2 |
| InChIKey | DEKQMDXMLSXIOE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde?
The IUPAC name of 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde (CID 129227138) is 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde.
What is the SMILES notation for 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde?
The canonical SMILES for 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde is O=CCn1ccc2scc(Br)c2c1=O.
What is the InChIKey of 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde?
The InChIKey is DEKQMDXMLSXIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrNO2S/c10-6-5-14-7-1-2-11(3-4-12)9(13)8(6)7/h1-2,4-5H,3H2.
What are the key properties of 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde?
2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde has a molecular weight of 272.12 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-4-oxothieno[3,2-c]pyridin-5-yl)acetaldehyde is sourced from PubChem (CID 129227138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).