About N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine
N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine (PubChem CID 129227412) has the molecular formula C23H43F2N
and a molecular weight of 371.60 g/mol. Its IUPAC name is N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine.
Molecular Properties
| Compound Name | N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine |
| PubChem CID | 129227412 |
| Molecular Formula | C23H43F2N |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 371.34 |
| IUPAC Name | N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine |
| SMILES | CCCCCC(CCC)C1=C(F)C[C@H](CN(CCC)CCCC)C[C@@H]1F |
| InChI | InChI=1S/C23H43F2N/c1-5-9-11-13-20(12-7-3)23-21(24)16-19(17-22(23)25)18-26(14-8-4)15-10-6-2/h19-21H,5-18H2,1-4H3/t19-,20?,21+/m1/s1 |
| InChIKey | CJGZITMWBBTAQC-TYVLQRECSA-N |
| XLogP | 7.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine?
The IUPAC name of N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine (CID 129227412) is N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine.
What is the SMILES notation for N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine?
The canonical SMILES for N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine is CCCCCC(CCC)C1=C(F)C[C@H](CN(CCC)CCCC)C[C@@H]1F.
What is the InChIKey of N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine?
The InChIKey is CJGZITMWBBTAQC-TYVLQRECSA-N. The full InChI is InChI=1S/C23H43F2N/c1-5-9-11-13-20(12-7-3)23-21(24)16-19(17-22(23)25)18-26(14-8-4)15-10-6-2/h19-21H,5-18H2,1-4H3/t19-,20?,21+/m1/s1.
What are the key properties of N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine?
N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine has a molecular weight of 371.60 g/mol, XLogP of 7.47, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,5S)-3,5-difluoro-4-nonan-4-ylcyclohex-3-en-1-yl]methyl]-N-propylbutan-1-amine is sourced from PubChem (CID 129227412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).