C19H17Cl2FN4O2 — CID 129227474
8-(5,6-dichloro-3-pyridinyl)-2-[2-(3-fluoro-3-methylazetidin-1-yl)-2-oxoethyl]-4-methylpyrrolo[1,2-a]pyrazin-1-one (PubChem CID 129227474) has the molecular formula C19H17Cl2FN4O2 and a molecular weight of 423.28 g/mol. Its IUPAC name is 8-(5,6-dichloro-3-pyridinyl)-2-[2-(3-fluoro-3-methylazetidin-1-yl)-2-oxoethyl]-4-methylpyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | 8-(5,6-dichloro-3-pyridinyl)-2-[2-(3-fluoro-3-methylazetidin-1-yl)-2-oxoethyl]-4-methylpyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 129227474 |
| Molecular Formula | C19H17Cl2FN4O2 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 8-(5,6-dichloro-3-pyridinyl)-2-[2-(3-fluoro-3-methylazetidin-1-yl)-2-oxoethyl]-4-methylpyrrolo[1,2-a]pyrazin-1-one |
| SMILES | Cc1cn(CC(=O)N2CC(C)(F)C2)c(=O)c2c(-c3cnc(Cl)c(Cl)c3)ccn12 |
| InChI | InChI=1S/C19H17Cl2FN4O2/c1-11-7-24(8-15(27)25-9-19(2,22)10-25)18(28)16-13(3-4-26(11)16)12-5-14(20)17(21)23-6-12/h3-7H,8-10H2,1-2H3 |
| InChIKey | LHQDSSLQVXFFJJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|