About (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine
(NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine (PubChem CID 129227751) has the molecular formula C7H12FNO
and a molecular weight of 145.18 g/mol. Its IUPAC name is (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine |
| PubChem CID | 129227751 |
| Molecular Formula | C7H12FNO |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine |
| SMILES | C/C=C/[C@@H](F)C/C(C)=N\O |
| InChI | InChI=1S/C7H12FNO/c1-3-4-7(8)5-6(2)9-10/h3-4,7,10H,5H2,1-2H3/b4-3+,9-6-/t7-/m1/s1 |
| InChIKey | DBOYYIWPIDXZGU-PPYPUIAUSA-N |
| XLogP | 2.14 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine?
The IUPAC name of (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine (CID 129227751) is (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine.
What is the SMILES notation for (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine?
The canonical SMILES for (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine is C/C=C/[C@@H](F)C/C(C)=N\O.
What is the InChIKey of (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine?
The InChIKey is DBOYYIWPIDXZGU-PPYPUIAUSA-N. The full InChI is InChI=1S/C7H12FNO/c1-3-4-7(8)5-6(2)9-10/h3-4,7,10H,5H2,1-2H3/b4-3+,9-6-/t7-/m1/s1.
What are the key properties of (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine?
(NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine has a molecular weight of 145.18 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(E,4S)-4-fluorohept-5-en-2-ylidene]hydroxylamine is sourced from PubChem (CID 129227751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).