C17H31NO — CID 129227850
N-[2-[(1E,4E)-2,5-dimethylcyclonona-1,4-dien-1-yl]oxyethyl]butan-2-amine (PubChem CID 129227850) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is N-[2-[(1E,4E)-2,5-dimethylcyclonona-1,4-dien-1-yl]oxyethyl]butan-2-amine.
| Compound Name | N-[2-[(1E,4E)-2,5-dimethylcyclonona-1,4-dien-1-yl]oxyethyl]butan-2-amine |
|---|---|
| PubChem CID | 129227850 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | N-[2-[(1E,4E)-2,5-dimethylcyclonona-1,4-dien-1-yl]oxyethyl]butan-2-amine |
| SMILES | CCC(C)NCCO/C1=C(\C)C/C=C(\C)CCCC1 |
| InChI | InChI=1S/C17H31NO/c1-5-16(4)18-12-13-19-17-9-7-6-8-14(2)10-11-15(17)3/h10,16,18H,5-9,11-13H2,1-4H3/b14-10+,17-15+ |
| InChIKey | XFKAVHLHMHLQKW-RZVSUCQVSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|