About 7-methylthieno[3,2-g][1]benzothiol-2-amine
7-methylthieno[3,2-g][1]benzothiol-2-amine (PubChem CID 129228320) has the molecular formula C11H9NS2
and a molecular weight of 219.33 g/mol. Its IUPAC name is 7-methylthieno[3,2-g][1]benzothiol-2-amine.
Molecular Properties
| Compound Name | 7-methylthieno[3,2-g][1]benzothiol-2-amine |
| PubChem CID | 129228320 |
| Molecular Formula | C11H9NS2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 7-methylthieno[3,2-g][1]benzothiol-2-amine |
| SMILES | Cc1cc2ccc3cc(N)sc3c2s1 |
| InChI | InChI=1S/C11H9NS2/c1-6-4-7-2-3-8-5-9(12)14-11(8)10(7)13-6/h2-5H,12H2,1H3 |
| InChIKey | GXRYLIZAZZHHCW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methylthieno[3,2-g][1]benzothiol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylthieno[3,2-g][1]benzothiol-2-amine?
The IUPAC name of 7-methylthieno[3,2-g][1]benzothiol-2-amine (CID 129228320) is 7-methylthieno[3,2-g][1]benzothiol-2-amine.
What is the SMILES notation for 7-methylthieno[3,2-g][1]benzothiol-2-amine?
The canonical SMILES for 7-methylthieno[3,2-g][1]benzothiol-2-amine is Cc1cc2ccc3cc(N)sc3c2s1.
What is the InChIKey of 7-methylthieno[3,2-g][1]benzothiol-2-amine?
The InChIKey is GXRYLIZAZZHHCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NS2/c1-6-4-7-2-3-8-5-9(12)14-11(8)10(7)13-6/h2-5H,12H2,1H3.
What are the key properties of 7-methylthieno[3,2-g][1]benzothiol-2-amine?
7-methylthieno[3,2-g][1]benzothiol-2-amine has a molecular weight of 219.33 g/mol, XLogP of 4.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylthieno[3,2-g][1]benzothiol-2-amine is sourced from PubChem (CID 129228320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).