About 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine
2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine (PubChem CID 129228763) has the molecular formula C15H10FN5O
and a molecular weight of 295.28 g/mol. Its IUPAC name is 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine |
| PubChem CID | 129228763 |
| Molecular Formula | C15H10FN5O |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine |
| SMILES | Nc1cc(-c2ccco2)nc(-c2c[nH]c3ncc(F)cc23)n1 |
| InChI | InChI=1S/C15H10FN5O/c16-8-4-9-10(7-19-14(9)18-6-8)15-20-11(5-13(17)21-15)12-2-1-3-22-12/h1-7H,(H,18,19)(H2,17,20,21) |
| InChIKey | VBLWCBWFGMWXIF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine?
The IUPAC name of 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine (CID 129228763) is 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine.
What is the SMILES notation for 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine?
The canonical SMILES for 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine is Nc1cc(-c2ccco2)nc(-c2c[nH]c3ncc(F)cc23)n1.
What is the InChIKey of 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine?
The InChIKey is VBLWCBWFGMWXIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FN5O/c16-8-4-9-10(7-19-14(9)18-6-8)15-20-11(5-13(17)21-15)12-2-1-3-22-12/h1-7H,(H,18,19)(H2,17,20,21).
What are the key properties of 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine?
2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine has a molecular weight of 295.28 g/mol, XLogP of 3.00, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-(furan-2-yl)pyrimidin-4-amine is sourced from PubChem (CID 129228763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).