C25H24FN5 — CID 129228814
N-[(2R)-2-bicyclo[2.2.2]octanyl]-2-(6-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-phenylpyrimidin-4-amine (PubChem CID 129228814) has the molecular formula C25H24FN5 and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[(2R)-2-bicyclo[2.2.2]octanyl]-2-(6-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-phenylpyrimidin-4-amine.
| Compound Name | N-[(2R)-2-bicyclo[2.2.2]octanyl]-2-(6-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 129228814 |
| Molecular Formula | C25H24FN5 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[(2R)-2-bicyclo[2.2.2]octanyl]-2-(6-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-6-phenylpyrimidin-4-amine |
| SMILES | Fc1ccc2c(-c3nc(N[C@@H]4CC5CCC4CC5)cc(-c4ccccc4)n3)c[nH]c2n1 |
| InChI | InChI=1S/C25H24FN5/c26-22-11-10-18-19(14-27-24(18)30-22)25-29-21(16-4-2-1-3-5-16)13-23(31-25)28-20-12-15-6-8-17(20)9-7-15/h1-5,10-11,13-15,17,20H,6-9,12H2,(H,27,30)(H,28,29,31)/t15?,17?,20-/m1/s1 |
| InChIKey | QDSKFZKOKJTNHH-MKJPBZQASA-N |
| XLogP | 5.82 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|