C16H24O4 — CID 12922891
methyl 3,5a,8-trimethyl-2-oxo-3a,4,5,6,7,8,8a,8b-octahydro-3H-cyclopenta[g][1]benzofuran-7-carboxylate (PubChem CID 12922891) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl 3,5a,8-trimethyl-2-oxo-3a,4,5,6,7,8,8a,8b-octahydro-3H-cyclopenta[g][1]benzofuran-7-carboxylate.
| Compound Name | methyl 3,5a,8-trimethyl-2-oxo-3a,4,5,6,7,8,8a,8b-octahydro-3H-cyclopenta[g][1]benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 12922891 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl 3,5a,8-trimethyl-2-oxo-3a,4,5,6,7,8,8a,8b-octahydro-3H-cyclopenta[g][1]benzofuran-7-carboxylate |
| SMILES | COC(=O)C1CC2(C)CCC3C(C)C(=O)OC3C2C1C |
| InChI | InChI=1S/C16H24O4/c1-8-11(15(18)19-4)7-16(3)6-5-10-9(2)14(17)20-13(10)12(8)16/h8-13H,5-7H2,1-4H3 |
| InChIKey | WSQJLDJEDQSYQP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |