About 2-iodo-N,N,4,6-tetramethylaniline
2-iodo-N,N,4,6-tetramethylaniline (PubChem CID 129229050) has the molecular formula C10H14IN
and a molecular weight of 275.13 g/mol. Its IUPAC name is 2-iodo-N,N,4,6-tetramethylaniline.
Molecular Properties
| Compound Name | 2-iodo-N,N,4,6-tetramethylaniline |
| PubChem CID | 129229050 |
| Molecular Formula | C10H14IN |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-iodo-N,N,4,6-tetramethylaniline |
| SMILES | Cc1cc(C)c(N(C)C)c(I)c1 |
| InChI | InChI=1S/C10H14IN/c1-7-5-8(2)10(12(3)4)9(11)6-7/h5-6H,1-4H3 |
| InChIKey | CNQTYJOZDCIHOE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-N,N,4,6-tetramethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-N,N,4,6-tetramethylaniline?
The IUPAC name of 2-iodo-N,N,4,6-tetramethylaniline (CID 129229050) is 2-iodo-N,N,4,6-tetramethylaniline.
What is the SMILES notation for 2-iodo-N,N,4,6-tetramethylaniline?
The canonical SMILES for 2-iodo-N,N,4,6-tetramethylaniline is Cc1cc(C)c(N(C)C)c(I)c1.
What is the InChIKey of 2-iodo-N,N,4,6-tetramethylaniline?
The InChIKey is CNQTYJOZDCIHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14IN/c1-7-5-8(2)10(12(3)4)9(11)6-7/h5-6H,1-4H3.
What are the key properties of 2-iodo-N,N,4,6-tetramethylaniline?
2-iodo-N,N,4,6-tetramethylaniline has a molecular weight of 275.13 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-N,N,4,6-tetramethylaniline is sourced from PubChem (CID 129229050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).