About 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole
5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole (PubChem CID 129229165) has the molecular formula C14H7FN2OS2
and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole |
| PubChem CID | 129229165 |
| Molecular Formula | C14H7FN2OS2 |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole |
| SMILES | Fc1cc(-c2cccs2)c2nonc2c1-c1cccs1 |
| InChI | InChI=1S/C14H7FN2OS2/c15-9-7-8(10-3-1-5-19-10)13-14(17-18-16-13)12(9)11-4-2-6-20-11/h1-7H |
| InChIKey | NLEJPQGROQIREI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole?
The IUPAC name of 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole (CID 129229165) is 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole.
What is the SMILES notation for 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole?
The canonical SMILES for 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole is Fc1cc(-c2cccs2)c2nonc2c1-c1cccs1.
What is the InChIKey of 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole?
The InChIKey is NLEJPQGROQIREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7FN2OS2/c15-9-7-8(10-3-1-5-19-10)13-14(17-18-16-13)12(9)11-4-2-6-20-11/h1-7H.
What are the key properties of 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole?
5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole has a molecular weight of 302.36 g/mol, XLogP of 4.82, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4,7-dithiophen-2-yl-2,1,3-benzoxadiazole is sourced from PubChem (CID 129229165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).